Erucamide

Erucamide

CAS No.: 112-84-5
Molecular Formula: CH3(CH2)7CH=CH(CH2)11CONH2
Formula Weight:337.58

 
 
Inquiry
 
 

This question is for testing whether or not you are a human visitor and to prevent automated spam submissions.