Chemical Products

Chrysomycin A

CAS No.:82196-88-1
Molecular formula:C28H28O9
Mocular Weight: 508.5

Chrysomycin B

CAS No.:83852-56-6
Molecular formula:C27H28O9
Mocular Weight: 496.509

L-β-diphenylalanine

CAS No.:149597-92-2
Molecular formula:C15H15NO2
Mocular Weight: 241.29

5-hydroxymethylfurfural

CAS No.:67-47-0
Molecular formula: C6H6O3
Mocular Weight: 126.11

2-Ethylhexyl Stearate

CAS No.:22047-49-0
Molecular formula: C26H52O2
Mocular Weight: 396.69

Erucamide

CAS No.: 112-84-5
Molecular Formula: CH3(CH2)7CH=CH(CH2)11CONH2
Formula Weight:337.58

Pentaerythrityl Tetraisostearate

CAS No.:62125-22-8
Molecular Formula:C77H148O8
Formula Weight:1202.02

Paclitaxel

CAS No.: 33069-62-4
Molecular Formula:C47H51NO14
Molecular Weight:854

Brassinolide

CAS No.:72962-43-7
Molecular Formula:C28H48O6
Formula Weight:480.69

1-Butyl-2,3-dimethylimidazolium chloride

CAS No.: 98892-75-2
Molecular Formula:C9H18N2
Molecular Weight:153.2447